About 5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol
5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol (PubChem CID 91594841) has the molecular formula C12H10N2OS
and a molecular weight of 230.29 g/mol. Its IUPAC name is 5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol.
Molecular Properties
| Compound Name | 5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol |
| PubChem CID | 91594841 |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol |
| SMILES | Cc1csc(-c2ccc3c(O)[nH]cc3c2)n1 |
| InChI | InChI=1S/C12H10N2OS/c1-7-6-16-12(14-7)8-2-3-10-9(4-8)5-13-11(10)15/h2-6,13,15H,1H3 |
| InChIKey | DPGLEPFLFKXDIG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol?
The IUPAC name of 5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol (CID 91594841) is 5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol.
What is the SMILES notation for 5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol?
The canonical SMILES for 5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol is Cc1csc(-c2ccc3c(O)[nH]cc3c2)n1.
What is the InChIKey of 5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol?
The InChIKey is DPGLEPFLFKXDIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2OS/c1-7-6-16-12(14-7)8-2-3-10-9(4-8)5-13-11(10)15/h2-6,13,15H,1H3.
What are the key properties of 5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol?
5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol has a molecular weight of 230.29 g/mol, XLogP of 3.31, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methyl-1,3-thiazol-2-yl)-2H-isoindol-1-ol is sourced from PubChem (CID 91594841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).