About (4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile
(4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile (PubChem CID 91595041) has the molecular formula C15H12ClN3
and a molecular weight of 269.74 g/mol. Its IUPAC name is (4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile.
Molecular Properties
| Compound Name | (4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile |
| PubChem CID | 91595041 |
| Molecular Formula | C15H12ClN3 |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile |
| SMILES | [C-]#[N+]C1=C(c2ccccc2Cl)N=C(C)C(C#N)[C@H]1C |
| InChI | InChI=1S/C15H12ClN3/c1-9-12(8-17)10(2)19-15(14(9)18-3)11-6-4-5-7-13(11)16/h4-7,9,12H,1-2H3/t9-,12?/m1/s1 |
| InChIKey | BIRAECJUUANONS-PKEIRNPWSA-N |
| XLogP | 4.18 |
| TPSA | 40.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile?
The IUPAC name of (4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile (CID 91595041) is (4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile.
What is the SMILES notation for (4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile?
The canonical SMILES for (4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile is [C-]#[N+]C1=C(c2ccccc2Cl)N=C(C)C(C#N)[C@H]1C.
What is the InChIKey of (4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile?
The InChIKey is BIRAECJUUANONS-PKEIRNPWSA-N. The full InChI is InChI=1S/C15H12ClN3/c1-9-12(8-17)10(2)19-15(14(9)18-3)11-6-4-5-7-13(11)16/h4-7,9,12H,1-2H3/t9-,12?/m1/s1.
What are the key properties of (4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile?
(4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile has a molecular weight of 269.74 g/mol, XLogP of 4.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-6-(2-chlorophenyl)-5-isocyano-2,4-dimethyl-3,4-dihydropyridine-3-carbonitrile is sourced from PubChem (CID 91595041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).