C20H37NO4Si — CID 91595253
(2R)-1-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-5-oxopyrrolidine-2-carboxylic acid (PubChem CID 91595253) has the molecular formula C20H37NO4Si and a molecular weight of 383.61 g/mol. Its IUPAC name is (2R)-1-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-5-oxopyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 91595253 |
| Molecular Formula | C20H37NO4Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | (2R)-1-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-5-oxopyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CCN1C(=O)CC[C@@H]1C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C20H37NO4Si/c1-20(2,3)26(4,5)25-17(15-9-7-6-8-10-15)13-14-21-16(19(23)24)11-12-18(21)22/h15-17H,6-14H2,1-5H3,(H,23,24)/t16-,17+/m1/s1 |
| InChIKey | CSLYINPXUJMXGD-SJORKVTESA-N |
| XLogP | 4.42 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|