C8H14F4O2 — CID 91595420
1,1,4,4-tetrafluoro-2,5-dimethylhexane-2,5-diol (PubChem CID 91595420) has the molecular formula C8H14F4O2 and a molecular weight of 218.19 g/mol. Its IUPAC name is 1,1,4,4-tetrafluoro-2,5-dimethylhexane-2,5-diol.
| Compound Name | 1,1,4,4-tetrafluoro-2,5-dimethylhexane-2,5-diol |
|---|---|
| PubChem CID | 91595420 |
| Molecular Formula | C8H14F4O2 |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1,1,4,4-tetrafluoro-2,5-dimethylhexane-2,5-diol |
| SMILES | CC(O)(CC(F)(F)C(C)(C)O)C(F)F |
| InChI | InChI=1S/C8H14F4O2/c1-6(2,13)8(11,12)4-7(3,14)5(9)10/h5,13-14H,4H2,1-3H3 |
| InChIKey | UOTOQHIXKDOXEN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |