C27H54O2 — CID 91595813
methyl 2,2,4,4,5,5,6,8,9,10,10,12,12-tridecamethyltridecanoate (PubChem CID 91595813) has the molecular formula C27H54O2 and a molecular weight of 410.73 g/mol. Its IUPAC name is methyl 2,2,4,4,5,5,6,8,9,10,10,12,12-tridecamethyltridecanoate.
| Compound Name | methyl 2,2,4,4,5,5,6,8,9,10,10,12,12-tridecamethyltridecanoate |
|---|---|
| PubChem CID | 91595813 |
| Molecular Formula | C27H54O2 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.41 |
| IUPAC Name | methyl 2,2,4,4,5,5,6,8,9,10,10,12,12-tridecamethyltridecanoate |
| SMILES | COC(=O)C(C)(C)CC(C)(C)C(C)(C)C(C)CC(C)C(C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C27H54O2/c1-19(21(3)24(7,8)17-23(4,5)6)16-20(2)27(13,14)26(11,12)18-25(9,10)22(28)29-15/h19-21H,16-18H2,1-15H3 |
| InChIKey | KSPJQMCSKNCMFF-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |