C23H28O6 — CID 91595934
(3E,5E)-5-methoxyhepta-1,3,5-triene;3-methoxy-2-methyl-4-methylidenecyclobut-2-en-1-one;4-methoxy-3-methyl-5-methylidenecyclopent-3-ene-1,2-dione (PubChem CID 91595934) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is (3E,5E)-5-methoxyhepta-1,3,5-triene;3-methoxy-2-methyl-4-methylidenecyclobut-2-en-1-one;4-methoxy-3-methyl-5-methylidenecyclopent-3-ene-1,2-dione.
| Compound Name | (3E,5E)-5-methoxyhepta-1,3,5-triene;3-methoxy-2-methyl-4-methylidenecyclobut-2-en-1-one;4-methoxy-3-methyl-5-methylidenecyclopent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 91595934 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (3E,5E)-5-methoxyhepta-1,3,5-triene;3-methoxy-2-methyl-4-methylidenecyclobut-2-en-1-one;4-methoxy-3-methyl-5-methylidenecyclopent-3-ene-1,2-dione |
| SMILES | C=C/C=C/C(=C\C)OC.C=C1C(=O)C(=O)C(C)=C1OC.C=C1C(=O)C(C)=C1OC |
| InChI | InChI=1S/C8H8O3.C8H12O.C7H8O2/c1-4-6(9)7(10)5(2)8(4)11-3;1-4-6-7-8(5-2)9-3;1-4-6(8)5(2)7(4)9-3/h1H2,2-3H3;4-7H,1H2,2-3H3;1H2,2-3H3/b;7-6+,8-5+; |
| InChIKey | NIRCUHPHRZSHAA-GXBSHZPZSA-N |
| XLogP | 3.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|