C30H33F3NO2+ — CID 91595991
8,8-diethyl-10-(4-methoxypent-2-en-2-yloxymethyl)-3-(trifluoromethyl)-11-azoniatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2(7),3,5,9,12,14,16,18-nonaene (PubChem CID 91595991) has the molecular formula C30H33F3NO2+ and a molecular weight of 496.59 g/mol. Its IUPAC name is 8,8-diethyl-10-(4-methoxypent-2-en-2-yloxymethyl)-3-(trifluoromethyl)-11-azoniatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2(7),3,5,9,12,14,16,18-nonaene.
| Compound Name | 8,8-diethyl-10-(4-methoxypent-2-en-2-yloxymethyl)-3-(trifluoromethyl)-11-azoniatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2(7),3,5,9,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 91595991 |
| Molecular Formula | C30H33F3NO2+ |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 8,8-diethyl-10-(4-methoxypent-2-en-2-yloxymethyl)-3-(trifluoromethyl)-11-azoniatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2(7),3,5,9,12,14,16,18-nonaene |
| SMILES | CCC1(CC)C=C(COC(C)=CC(C)OC)[n+]2c(ccc3ccccc32)-c2c(C(F)(F)F)cccc21 |
| InChI | InChI=1S/C30H33F3NO2/c1-6-29(7-2)18-23(19-36-21(4)17-20(3)35-5)34-26-14-9-8-11-22(26)15-16-27(34)28-24(29)12-10-13-25(28)30(31,32)33/h8-18,20H,6-7,19H2,1-5H3/q+1 |
| InChIKey | QOKFPLLPUVVHSM-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|