About ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol
ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol (PubChem CID 91596649) has the molecular formula C16H20N4OS
and a molecular weight of 316.43 g/mol. Its IUPAC name is ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol |
| PubChem CID | 91596649 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol |
| SMILES | CCc1ccccc1.CNc1nc(-c2cn[nH]c2)c(CO)s1 |
| InChI | InChI=1S/C8H10N4OS.C8H10/c1-9-8-12-7(6(4-13)14-8)5-2-10-11-3-5;1-2-8-6-4-3-5-7-8/h2-3,13H,4H2,1H3,(H,9,12)(H,10,11);3-7H,2H2,1H3 |
| InChIKey | QRMQLNUEYNODEJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol?
The IUPAC name of ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol (CID 91596649) is ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol?
The canonical SMILES for ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol is CCc1ccccc1.CNc1nc(-c2cn[nH]c2)c(CO)s1.
What is the InChIKey of ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol?
The InChIKey is QRMQLNUEYNODEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4OS.C8H10/c1-9-8-12-7(6(4-13)14-8)5-2-10-11-3-5;1-2-8-6-4-3-5-7-8/h2-3,13H,4H2,1H3,(H,9,12)(H,10,11);3-7H,2H2,1H3.
What are the key properties of ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol?
ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol has a molecular weight of 316.43 g/mol, XLogP of 3.32, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethylbenzene;[2-(methylamino)-4-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 91596649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).