C22H39NO3 — CID 91596754
1-(2,5-dihydroxypyrrol-1-yl)-6-hexan-2-yl-7-methylundecan-1-one (PubChem CID 91596754) has the molecular formula C22H39NO3 and a molecular weight of 365.56 g/mol. Its IUPAC name is 1-(2,5-dihydroxypyrrol-1-yl)-6-hexan-2-yl-7-methylundecan-1-one.
| Compound Name | 1-(2,5-dihydroxypyrrol-1-yl)-6-hexan-2-yl-7-methylundecan-1-one |
|---|---|
| PubChem CID | 91596754 |
| Molecular Formula | C22H39NO3 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | 1-(2,5-dihydroxypyrrol-1-yl)-6-hexan-2-yl-7-methylundecan-1-one |
| SMILES | CCCCC(C)C(CCCCC(=O)n1c(O)ccc1O)C(C)CCCC |
| InChI | InChI=1S/C22H39NO3/c1-5-7-11-17(3)19(18(4)12-8-6-2)13-9-10-14-20(24)23-21(25)15-16-22(23)26/h15-19,25-26H,5-14H2,1-4H3 |
| InChIKey | ODEUZRHBJKUSIR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|