About CID 91596760
CID 91596760 (PubChem CID 91596760) has the molecular formula C27H38N2O3
and a molecular weight of 438.61 g/mol.
Molecular Properties
| Compound Name | CID 91596760 |
| PubChem CID | 91596760 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | — |
| SMILES | C=C(C)C1=NC2(C(=O)N1C(C)C)c1cc(OCC(C)C)ccc1CC21CCC(OC)CC1 |
| InChI | InChI=1S/C27H38N2O3/c1-17(2)16-32-22-9-8-20-15-26(12-10-21(31-7)11-13-26)27(23(20)14-22)25(30)29(19(5)6)24(28-27)18(3)4/h8-9,14,17,19,21H,3,10-13,15-16H2,1-2,4-7H3 |
| InChIKey | DMQBHAZGQWYSTB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 91596760 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91596760?
The IUPAC name of CID 91596760 (CID 91596760) is not available.
What is the SMILES notation for CID 91596760?
The canonical SMILES for CID 91596760 is C=C(C)C1=NC2(C(=O)N1C(C)C)c1cc(OCC(C)C)ccc1CC21CCC(OC)CC1.
What is the InChIKey of CID 91596760?
The InChIKey is DMQBHAZGQWYSTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H38N2O3/c1-17(2)16-32-22-9-8-20-15-26(12-10-21(31-7)11-13-26)27(23(20)14-22)25(30)29(19(5)6)24(28-27)18(3)4/h8-9,14,17,19,21H,3,10-13,15-16H2,1-2,4-7H3.
What are the key properties of CID 91596760?
CID 91596760 has a molecular weight of 438.61 g/mol, XLogP of 5.27, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91596760 is sourced from PubChem (CID 91596760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).