About 3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline
3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline (PubChem CID 91597433) has the molecular formula C23H28N2
and a molecular weight of 332.49 g/mol. Its IUPAC name is 3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline.
Molecular Properties
| Compound Name | 3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline |
| PubChem CID | 91597433 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline |
| SMILES | CCCC/N=C/c1cc(N(C)C)ccc1C1C(C)=Cc2ccccc21 |
| InChI | InChI=1S/C23H28N2/c1-5-6-13-24-16-19-15-20(25(3)4)11-12-22(19)23-17(2)14-18-9-7-8-10-21(18)23/h7-12,14-16,23H,5-6,13H2,1-4H3/b24-16+ |
| InChIKey | KNBNOLPWEQNHRT-LFVJCYFKSA-N |
| XLogP | 5.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline?
The IUPAC name of 3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline (CID 91597433) is 3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline.
What is the SMILES notation for 3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline?
The canonical SMILES for 3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline is CCCC/N=C/c1cc(N(C)C)ccc1C1C(C)=Cc2ccccc21.
What is the InChIKey of 3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline?
The InChIKey is KNBNOLPWEQNHRT-LFVJCYFKSA-N. The full InChI is InChI=1S/C23H28N2/c1-5-6-13-24-16-19-15-20(25(3)4)11-12-22(19)23-17(2)14-18-9-7-8-10-21(18)23/h7-12,14-16,23H,5-6,13H2,1-4H3/b24-16+.
What are the key properties of 3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline?
3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline has a molecular weight of 332.49 g/mol, XLogP of 5.52, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(butyliminomethyl)-N,N-dimethyl-4-(2-methyl-1H-inden-1-yl)aniline is sourced from PubChem (CID 91597433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).