C25H27FN4O — CID 91597634
1-[1-[5-fluoro-6-(pyridine-3-carboximidoyl)-2-pyridinyl]-4-methylpiperidin-3-yl]-1-phenylethanol (PubChem CID 91597634) has the molecular formula C25H27FN4O and a molecular weight of 418.52 g/mol. Its IUPAC name is 1-[1-[5-fluoro-6-(pyridine-3-carboximidoyl)-2-pyridinyl]-4-methylpiperidin-3-yl]-1-phenylethanol.
| Compound Name | 1-[1-[5-fluoro-6-(pyridine-3-carboximidoyl)-2-pyridinyl]-4-methylpiperidin-3-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 91597634 |
| Molecular Formula | C25H27FN4O |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-[1-[5-fluoro-6-(pyridine-3-carboximidoyl)-2-pyridinyl]-4-methylpiperidin-3-yl]-1-phenylethanol |
| SMILES | [H]/N=C(\c1cccnc1)c1nc(N2CCC(C)C(C(C)(O)c3ccccc3)C2)ccc1F |
| InChI | InChI=1S/C25H27FN4O/c1-17-12-14-30(16-20(17)25(2,31)19-8-4-3-5-9-19)22-11-10-21(26)24(29-22)23(27)18-7-6-13-28-15-18/h3-11,13,15,17,20,27,31H,12,14,16H2,1-2H3/b27-23+ |
| InChIKey | KEMAGAUCRVUYKV-SLEBQGDGSA-N |
| XLogP | 4.40 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|