C22H24F3N3O4 — CID 91597689
1-isocyanato-4-(trifluoromethoxy)benzene;methyl 3-(anilinomethyl)piperidine-1-carboxylate (PubChem CID 91597689) has the molecular formula C22H24F3N3O4 and a molecular weight of 451.45 g/mol. Its IUPAC name is 1-isocyanato-4-(trifluoromethoxy)benzene;methyl 3-(anilinomethyl)piperidine-1-carboxylate.
| Compound Name | 1-isocyanato-4-(trifluoromethoxy)benzene;methyl 3-(anilinomethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91597689 |
| Molecular Formula | C22H24F3N3O4 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-isocyanato-4-(trifluoromethoxy)benzene;methyl 3-(anilinomethyl)piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC(CNc2ccccc2)C1.O=C=Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H20N2O2.C8H4F3NO2/c1-18-14(17)16-9-5-6-12(11-16)10-15-13-7-3-2-4-8-13;9-8(10,11)14-7-3-1-6(2-4-7)12-5-13/h2-4,7-8,12,15H,5-6,9-11H2,1H3;1-4H |
| InChIKey | HZLCNKIMERFGRO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|