About N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine
N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine (PubChem CID 91597724) has the molecular formula C17H32N2
and a molecular weight of 264.46 g/mol. Its IUPAC name is N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine.
Molecular Properties
| Compound Name | N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine |
| PubChem CID | 91597724 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine |
| SMILES | C=C=CCCCNCCCC(=C)CCCNCCC |
| InChI | InChI=1S/C17H32N2/c1-4-6-7-8-14-19-16-10-12-17(3)11-9-15-18-13-5-2/h6,18-19H,1,3,5,7-16H2,2H3 |
| InChIKey | KJWIWKYKLOYRHG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine?
The IUPAC name of N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine (CID 91597724) is N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine.
What is the SMILES notation for N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine?
The canonical SMILES for N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine is C=C=CCCCNCCCC(=C)CCCNCCC.
What is the InChIKey of N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine?
The InChIKey is KJWIWKYKLOYRHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2/c1-4-6-7-8-14-19-16-10-12-17(3)11-9-15-18-13-5-2/h6,18-19H,1,3,5,7-16H2,2H3.
What are the key properties of N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine?
N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine has a molecular weight of 264.46 g/mol, XLogP of 3.81, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexa-4,5-dienyl-4-methylidene-N'-propylheptane-1,7-diamine is sourced from PubChem (CID 91597724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).