C35H49F3O7 — CID 91598192
[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-(2-oxooxolan-3-yl)methyl] 2,2,2-trifluoroacetate;3-[(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-hydroxymethyl]oxolan-2-one (PubChem CID 91598192) has the molecular formula C35H49F3O7 and a molecular weight of 638.76 g/mol. Its IUPAC name is [(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-(2-oxooxolan-3-yl)methyl] 2,2,2-trifluoroacetate;3-[(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-hydroxymethyl]oxolan-2-one.
| Compound Name | [(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-(2-oxooxolan-3-yl)methyl] 2,2,2-trifluoroacetate;3-[(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-hydroxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 91598192 |
| Molecular Formula | C35H49F3O7 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.34 |
| IUPAC Name | [(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-(2-oxooxolan-3-yl)methyl] 2,2,2-trifluoroacetate;3-[(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-hydroxymethyl]oxolan-2-one |
| SMILES | CC1C(C)C2CC1C1C3CC(C(O)C4CCOC4=O)C(C3)C21.CC1C2CC(C1C)C(C(OC(=O)C(F)(F)F)C1CCOC1=O)C2 |
| InChI | InChI=1S/C19H28O3.C16H21F3O4/c1-8-9(2)13-7-12(8)16-10-5-14(17(13)16)15(6-10)18(20)11-3-4-22-19(11)21;1-7-8(2)11-5-9(7)6-12(11)13(10-3-4-22-14(10)20)23-15(21)16(17,18)19/h8-18,20H,3-7H2,1-2H3;7-13H,3-6H2,1-2H3 |
| InChIKey | ZZMLGVXDMZSGLU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|