About 5-ethynyl-2-methylisoindole-1,3-dione;toluene
5-ethynyl-2-methylisoindole-1,3-dione;toluene (PubChem CID 91598252) has the molecular formula C18H15NO2
and a molecular weight of 277.32 g/mol. Its IUPAC name is 5-ethynyl-2-methylisoindole-1,3-dione;toluene.
Molecular Properties
| Compound Name | 5-ethynyl-2-methylisoindole-1,3-dione;toluene |
| PubChem CID | 91598252 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 5-ethynyl-2-methylisoindole-1,3-dione;toluene |
| SMILES | C#Cc1ccc2c(c1)C(=O)N(C)C2=O.Cc1ccccc1 |
| InChI | InChI=1S/C11H7NO2.C7H8/c1-3-7-4-5-8-9(6-7)11(14)12(2)10(8)13;1-7-5-3-2-4-6-7/h1,4-6H,2H3;2-6H,1H3 |
| InChIKey | RHJNFZIPRHGMLX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-2-methylisoindole-1,3-dione;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-2-methylisoindole-1,3-dione;toluene?
The IUPAC name of 5-ethynyl-2-methylisoindole-1,3-dione;toluene (CID 91598252) is 5-ethynyl-2-methylisoindole-1,3-dione;toluene.
What is the SMILES notation for 5-ethynyl-2-methylisoindole-1,3-dione;toluene?
The canonical SMILES for 5-ethynyl-2-methylisoindole-1,3-dione;toluene is C#Cc1ccc2c(c1)C(=O)N(C)C2=O.Cc1ccccc1.
What is the InChIKey of 5-ethynyl-2-methylisoindole-1,3-dione;toluene?
The InChIKey is RHJNFZIPRHGMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO2.C7H8/c1-3-7-4-5-8-9(6-7)11(14)12(2)10(8)13;1-7-5-3-2-4-6-7/h1,4-6H,2H3;2-6H,1H3.
What are the key properties of 5-ethynyl-2-methylisoindole-1,3-dione;toluene?
5-ethynyl-2-methylisoindole-1,3-dione;toluene has a molecular weight of 277.32 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-2-methylisoindole-1,3-dione;toluene is sourced from PubChem (CID 91598252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).