C27H36FNO — CID 91598865
1-[(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-N-[(4-fluorophenyl)methoxy]methanimine (PubChem CID 91598865) has the molecular formula C27H36FNO and a molecular weight of 409.59 g/mol. Its IUPAC name is 1-[(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-N-[(4-fluorophenyl)methoxy]methanimine.
| Compound Name | 1-[(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-N-[(4-fluorophenyl)methoxy]methanimine |
|---|---|
| PubChem CID | 91598865 |
| Molecular Formula | C27H36FNO |
| Molecular Weight | 409.59 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | 1-[(1R,4aR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-N-[(4-fluorophenyl)methoxy]methanimine |
| SMILES | C=C[C@@]1(C)CC=C2[C@@H](CC[C@H]3[C@@]2(C)CCC[C@@]3(C)C=NOCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C27H36FNO/c1-5-25(2)16-13-23-21(17-25)9-12-24-26(3,14-6-15-27(23,24)4)19-29-30-18-20-7-10-22(28)11-8-20/h5,7-8,10-11,13,19,21,24H,1,6,9,12,14-18H2,2-4H3/t21-,24+,25-,26-,27-/m0/s1 |
| InChIKey | GVDZCNLUGRQULK-KOMOQGMXSA-N |
| XLogP | 7.46 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.59 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|