About prop-1-enyl 3-hydroxypropanoate
prop-1-enyl 3-hydroxypropanoate (PubChem CID 91598905) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is prop-1-enyl 3-hydroxypropanoate.
Molecular Properties
| Compound Name | prop-1-enyl 3-hydroxypropanoate |
| PubChem CID | 91598905 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | prop-1-enyl 3-hydroxypropanoate |
| SMILES | CC=COC(=O)CCO |
| InChI | InChI=1S/C6H10O3/c1-2-5-9-6(8)3-4-7/h2,5,7H,3-4H2,1H3 |
| InChIKey | IBBFTSMIQRATJG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze prop-1-enyl 3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-enyl 3-hydroxypropanoate?
The IUPAC name of prop-1-enyl 3-hydroxypropanoate (CID 91598905) is prop-1-enyl 3-hydroxypropanoate.
What is the SMILES notation for prop-1-enyl 3-hydroxypropanoate?
The canonical SMILES for prop-1-enyl 3-hydroxypropanoate is CC=COC(=O)CCO.
What is the InChIKey of prop-1-enyl 3-hydroxypropanoate?
The InChIKey is IBBFTSMIQRATJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c1-2-5-9-6(8)3-4-7/h2,5,7H,3-4H2,1H3.
What are the key properties of prop-1-enyl 3-hydroxypropanoate?
prop-1-enyl 3-hydroxypropanoate has a molecular weight of 130.14 g/mol, XLogP of 0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-enyl 3-hydroxypropanoate is sourced from PubChem (CID 91598905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).