About 6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran
6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran (PubChem CID 91598969) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran |
| PubChem CID | 91598969 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran |
| SMILES | C=CC=C(OCC)C1C=CCCO1 |
| InChI | InChI=1S/C11H16O2/c1-3-7-10(12-4-2)11-8-5-6-9-13-11/h3,5,7-8,11H,1,4,6,9H2,2H3 |
| InChIKey | RBPMWYOZBUJGJV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran?
The IUPAC name of 6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran (CID 91598969) is 6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran.
What is the SMILES notation for 6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran?
The canonical SMILES for 6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran is C=CC=C(OCC)C1C=CCCO1.
What is the InChIKey of 6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran?
The InChIKey is RBPMWYOZBUJGJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-3-7-10(12-4-2)11-8-5-6-9-13-11/h3,5,7-8,11H,1,4,6,9H2,2H3.
What are the key properties of 6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran?
6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran has a molecular weight of 180.25 g/mol, XLogP of 2.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-ethoxybuta-1,3-dienyl)-3,6-dihydro-2H-pyran is sourced from PubChem (CID 91598969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).