About 1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane
1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane (PubChem CID 91599172) has the molecular formula C14H24
and a molecular weight of 192.35 g/mol. Its IUPAC name is 1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane.
Molecular Properties
| Compound Name | 1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane |
| PubChem CID | 91599172 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane |
| SMILES | CCC(C)C12CCC3CCC(C1C)C32 |
| InChI | InChI=1S/C14H24/c1-4-9(2)14-8-7-11-5-6-12(10(14)3)13(11)14/h9-13H,4-8H2,1-3H3 |
| InChIKey | HHBLFTNFQPHDTL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane?
The IUPAC name of 1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane (CID 91599172) is 1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane.
What is the SMILES notation for 1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane?
The canonical SMILES for 1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane is CCC(C)C12CCC3CCC(C1C)C32.
What is the InChIKey of 1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane?
The InChIKey is HHBLFTNFQPHDTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24/c1-4-9(2)14-8-7-11-5-6-12(10(14)3)13(11)14/h9-13H,4-8H2,1-3H3.
What are the key properties of 1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane?
1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane has a molecular weight of 192.35 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-2-methyltricyclo[4.2.1.03,9]nonane is sourced from PubChem (CID 91599172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).