C20H34O6 — CID 91599308
(2R,3S)-1-[(3S,4S)-6-ethyl-4,6-dihydroxyoxan-3-yl]-3-hydroxy-2-(hydroxymethyl)-3-[(2R)-1-methyl-2-[(Z,2S)-pent-3-en-2-yl]cyclopropyl]propan-1-one (PubChem CID 91599308) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is (2R,3S)-1-[(3S,4S)-6-ethyl-4,6-dihydroxyoxan-3-yl]-3-hydroxy-2-(hydroxymethyl)-3-[(2R)-1-methyl-2-[(Z,2S)-pent-3-en-2-yl]cyclopropyl]propan-1-one.
| Compound Name | (2R,3S)-1-[(3S,4S)-6-ethyl-4,6-dihydroxyoxan-3-yl]-3-hydroxy-2-(hydroxymethyl)-3-[(2R)-1-methyl-2-[(Z,2S)-pent-3-en-2-yl]cyclopropyl]propan-1-one |
|---|---|
| PubChem CID | 91599308 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (2R,3S)-1-[(3S,4S)-6-ethyl-4,6-dihydroxyoxan-3-yl]-3-hydroxy-2-(hydroxymethyl)-3-[(2R)-1-methyl-2-[(Z,2S)-pent-3-en-2-yl]cyclopropyl]propan-1-one |
| SMILES | C/C=C\[C@H](C)[C@H]1CC1(C)[C@@H](O)[C@@H](CO)C(=O)[C@H]1COC(O)(CC)C[C@@H]1O |
| InChI | InChI=1S/C20H34O6/c1-5-7-12(3)15-8-19(15,4)18(24)13(10-21)17(23)14-11-26-20(25,6-2)9-16(14)22/h5,7,12-16,18,21-22,24-25H,6,8-11H2,1-4H3/b7-5-/t12-,13-,14-,15+,16-,18-,19?,20?/m0/s1 |
| InChIKey | UWJUAVXEWAQVOU-NUTBVPLFSA-N |
| XLogP | 1.26 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|