About 4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal
4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal (PubChem CID 91599455) has the molecular formula C9H14O9S-2
and a molecular weight of 298.27 g/mol. Its IUPAC name is 4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal.
Molecular Properties
| Compound Name | 4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal |
| PubChem CID | 91599455 |
| Molecular Formula | C9H14O9S-2 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal |
| SMILES | CCC=O.O=C([O-])C1CC(O)C(OS(=O)(=O)[O-])CO1 |
| InChI | InChI=1S/C6H10O8S.C3H6O/c7-3-1-4(6(8)9)13-2-5(3)14-15(10,11)12;1-2-3-4/h3-5,7H,1-2H2,(H,8,9)(H,10,11,12);3H,2H2,1H3/p-2 |
| InChIKey | IITUXYCTNPZZPI-UHFFFAOYSA-L |
| XLogP | -2.67 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal?
The IUPAC name of 4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal (CID 91599455) is 4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal.
What is the SMILES notation for 4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal?
The canonical SMILES for 4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal is CCC=O.O=C([O-])C1CC(O)C(OS(=O)(=O)[O-])CO1.
What is the InChIKey of 4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal?
The InChIKey is IITUXYCTNPZZPI-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H10O8S.C3H6O/c7-3-1-4(6(8)9)13-2-5(3)14-15(10,11)12;1-2-3-4/h3-5,7H,1-2H2,(H,8,9)(H,10,11,12);3H,2H2,1H3/p-2.
What are the key properties of 4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal?
4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal has a molecular weight of 298.27 g/mol, XLogP of -2.67, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-5-sulfonatooxyoxane-2-carboxylate;propanal is sourced from PubChem (CID 91599455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).