About N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine
N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine (PubChem CID 91599849) has the molecular formula C23H24FN3O
and a molecular weight of 377.46 g/mol. Its IUPAC name is N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine |
| PubChem CID | 91599849 |
| Molecular Formula | C23H24FN3O |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine |
| SMILES | CN(CCCOc1ccc2c(c1)CCC2)c1ncc(-c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C23H24FN3O/c1-27(12-3-13-28-22-11-8-17-4-2-5-19(17)14-22)23-25-15-20(16-26-23)18-6-9-21(24)10-7-18/h6-11,14-16H,2-5,12-13H2,1H3 |
| InChIKey | CYSSVSZRFSNLJE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine?
The IUPAC name of N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine (CID 91599849) is N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine.
What is the SMILES notation for N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine?
The canonical SMILES for N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine is CN(CCCOc1ccc2c(c1)CCC2)c1ncc(-c2ccc(F)cc2)cn1.
What is the InChIKey of N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine?
The InChIKey is CYSSVSZRFSNLJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24FN3O/c1-27(12-3-13-28-22-11-8-17-4-2-5-19(17)14-22)23-25-15-20(16-26-23)18-6-9-21(24)10-7-18/h6-11,14-16H,2-5,12-13H2,1H3.
What are the key properties of N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine?
N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine has a molecular weight of 377.46 g/mol, XLogP of 4.68, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-5-(4-fluorophenyl)-N-methylpyrimidin-2-amine is sourced from PubChem (CID 91599849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).