C11H18O — CID 91599949
3-(methoxymethyl)-2,4-dimethylhepta-1,3,5-triene (PubChem CID 91599949) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 3-(methoxymethyl)-2,4-dimethylhepta-1,3,5-triene.
| Compound Name | 3-(methoxymethyl)-2,4-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 91599949 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 3-(methoxymethyl)-2,4-dimethylhepta-1,3,5-triene |
| SMILES | C=C(C)C(COC)=C(C)C=CC |
| InChI | InChI=1S/C11H18O/c1-6-7-10(4)11(8-12-5)9(2)3/h6-7H,2,8H2,1,3-5H3 |
| InChIKey | DDDCBFAUQAPECB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|