C16H14N4S — CID 91600243
4-(3-ethylphenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaene (PubChem CID 91600243) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-(3-ethylphenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaene.
| Compound Name | 4-(3-ethylphenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaene |
|---|---|
| PubChem CID | 91600243 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-(3-ethylphenyl)-12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaene |
| SMILES | CCc1cccc(-c2nc3c(ncc4ncn(C)c43)s2)c1 |
| InChI | InChI=1S/C16H14N4S/c1-3-10-5-4-6-11(7-10)15-19-13-14-12(18-9-20(14)2)8-17-16(13)21-15/h4-9H,3H2,1-2H3 |
| InChIKey | GDFXEZXYAQDLAH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |