About [2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol
[2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol (PubChem CID 91600484) has the molecular formula C8H8F2S2
and a molecular weight of 206.28 g/mol. Its IUPAC name is [2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol.
Molecular Properties
| Compound Name | [2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol |
| PubChem CID | 91600484 |
| Molecular Formula | C8H8F2S2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | [2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol |
| SMILES | Fc1cc(CS)c(F)cc1CS |
| InChI | InChI=1S/C8H8F2S2/c9-7-1-5(3-11)8(10)2-6(7)4-12/h1-2,11-12H,3-4H2 |
| InChIKey | FKMWBWWPTICQLG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol?
The IUPAC name of [2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol (CID 91600484) is [2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol.
What is the SMILES notation for [2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol?
The canonical SMILES for [2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol is Fc1cc(CS)c(F)cc1CS.
What is the InChIKey of [2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol?
The InChIKey is FKMWBWWPTICQLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2S2/c9-7-1-5(3-11)8(10)2-6(7)4-12/h1-2,11-12H,3-4H2.
What are the key properties of [2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol?
[2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol has a molecular weight of 206.28 g/mol, XLogP of 2.82, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-difluoro-4-(sulfanylmethyl)phenyl]methanethiol is sourced from PubChem (CID 91600484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).