C20H37F3O4 — CID 91600817
hexyl 2,2-dimethylbutanoate;2,2,2-trifluoroethyl 2,2-dimethylbutanoate (PubChem CID 91600817) has the molecular formula C20H37F3O4 and a molecular weight of 398.51 g/mol. Its IUPAC name is hexyl 2,2-dimethylbutanoate;2,2,2-trifluoroethyl 2,2-dimethylbutanoate.
| Compound Name | hexyl 2,2-dimethylbutanoate;2,2,2-trifluoroethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91600817 |
| Molecular Formula | C20H37F3O4 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | hexyl 2,2-dimethylbutanoate;2,2,2-trifluoroethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(F)(F)F.CCCCCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C12H24O2.C8H13F3O2/c1-5-7-8-9-10-14-11(13)12(3,4)6-2;1-4-7(2,3)6(12)13-5-8(9,10)11/h5-10H2,1-4H3;4-5H2,1-3H3 |
| InChIKey | SKEBTFNIFYBIBX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|