About 2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide
2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide (PubChem CID 91600834) has the molecular formula C7H11FN4O
and a molecular weight of 186.19 g/mol. Its IUPAC name is 2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide |
| PubChem CID | 91600834 |
| Molecular Formula | C7H11FN4O |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide |
| SMILES | CCn1ncnc1C(=O)NCCF |
| InChI | InChI=1S/C7H11FN4O/c1-2-12-6(10-5-11-12)7(13)9-4-3-8/h5H,2-4H2,1H3,(H,9,13) |
| InChIKey | DLLCMWGSEAUTMP-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide?
The IUPAC name of 2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide (CID 91600834) is 2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide is CCn1ncnc1C(=O)NCCF.
What is the InChIKey of 2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide?
The InChIKey is DLLCMWGSEAUTMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11FN4O/c1-2-12-6(10-5-11-12)7(13)9-4-3-8/h5H,2-4H2,1H3,(H,9,13).
What are the key properties of 2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide?
2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide has a molecular weight of 186.19 g/mol, XLogP of -0.00, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-(2-fluoroethyl)-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 91600834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).