About 9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane
9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane (PubChem CID 91601018) has the molecular formula C10H22N3+
and a molecular weight of 184.31 g/mol. Its IUPAC name is 9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane |
| PubChem CID | 91601018 |
| Molecular Formula | C10H22N3+ |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane |
| SMILES | C[N+]1(C)CCC2(CC1)NCCCN2 |
| InChI | InChI=1S/C10H22N3/c1-13(2)8-4-10(5-9-13)11-6-3-7-12-10/h11-12H,3-9H2,1-2H3/q+1 |
| InChIKey | DAASRIYOMKXZHA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane?
The IUPAC name of 9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane (CID 91601018) is 9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane.
What is the SMILES notation for 9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane?
The canonical SMILES for 9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane is C[N+]1(C)CCC2(CC1)NCCCN2.
What is the InChIKey of 9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane?
The InChIKey is DAASRIYOMKXZHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N3/c1-13(2)8-4-10(5-9-13)11-6-3-7-12-10/h11-12H,3-9H2,1-2H3/q+1.
What are the key properties of 9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane?
9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane has a molecular weight of 184.31 g/mol, XLogP of 0.14, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dimethyl-1,5-diaza-9-azoniaspiro[5.5]undecane is sourced from PubChem (CID 91601018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).