About 2-methylpentane
2-methylpentane (PubChem CID 91601298) has the molecular formula C6H13-
and a molecular weight of 85.17 g/mol. Its IUPAC name is 2-methylpentane.
Molecular Properties
| Compound Name | 2-methylpentane |
| PubChem CID | 91601298 |
| Molecular Formula | C6H13- |
| Molecular Weight | 85.17 g/mol |
| Exact Mass | 85.10 |
| IUPAC Name | 2-methylpentane |
| SMILES | [CH2-]CCC(C)C |
| InChI | InChI=1S/C6H13/c1-4-5-6(2)3/h6H,1,4-5H2,2-3H3/q-1 |
| InChIKey | LIORARJWVKONHI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentane?
The IUPAC name of 2-methylpentane (CID 91601298) is 2-methylpentane.
What is the SMILES notation for 2-methylpentane?
The canonical SMILES for 2-methylpentane is [CH2-]CCC(C)C.
What is the InChIKey of 2-methylpentane?
The InChIKey is LIORARJWVKONHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13/c1-4-5-6(2)3/h6H,1,4-5H2,2-3H3/q-1.
What are the key properties of 2-methylpentane?
2-methylpentane has a molecular weight of 85.17 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentane is sourced from PubChem (CID 91601298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).