C32H18O19S6 — CID 91602020
8-(3-hydroxy-6,8-disulfopyren-1-yl)sulfonyloxypyrene-1,3,6-trisulfonic acid (PubChem CID 91602020) has the molecular formula C32H18O19S6 and a molecular weight of 898.88 g/mol. Its IUPAC name is 8-(3-hydroxy-6,8-disulfopyren-1-yl)sulfonyloxypyrene-1,3,6-trisulfonic acid.
| Compound Name | 8-(3-hydroxy-6,8-disulfopyren-1-yl)sulfonyloxypyrene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 91602020 |
| Molecular Formula | C32H18O19S6 |
| Molecular Weight | 898.88 g/mol |
| Exact Mass | 897.88 |
| IUPAC Name | 8-(3-hydroxy-6,8-disulfopyren-1-yl)sulfonyloxypyrene-1,3,6-trisulfonic acid |
| SMILES | O=S(=O)(O)c1cc(OS(=O)(=O)c2cc(O)c3ccc4c(S(=O)(=O)O)cc(S(=O)(=O)O)c5ccc2c3c45)c2ccc3c(S(=O)(=O)O)cc(S(=O)(=O)O)c4ccc1c2c34 |
| InChI | InChI=1S/C32H18O19S6/c33-21-9-28(20-8-7-18-26(55(43,44)45)11-24(53(37,38)39)16-3-1-13(21)29(20)31(16)18)57(49,50)51-22-10-23(52(34,35)36)15-5-6-19-27(56(46,47)48)12-25(54(40,41)42)17-4-2-14(22)30(15)32(17)19/h1-12,33H,(H,34,35,36)(H,37,38,39)(H,40,41,42)(H,43,44,45)(H,46,47,48) |
| InChIKey | FKNDQDHNTZXXOM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 335.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.88 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|