About 1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol
1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol (PubChem CID 91602244) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol.
Molecular Properties
| Compound Name | 1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol |
| PubChem CID | 91602244 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol |
| SMILES | CC(C)(C)C=CC(O)C1OC1(C)C |
| InChI | InChI=1S/C11H20O2/c1-10(2,3)7-6-8(12)9-11(4,5)13-9/h6-9,12H,1-5H3 |
| InChIKey | ZQAUSFAYHMZIFR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol?
The IUPAC name of 1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol (CID 91602244) is 1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol.
What is the SMILES notation for 1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol?
The canonical SMILES for 1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol is CC(C)(C)C=CC(O)C1OC1(C)C.
What is the InChIKey of 1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol?
The InChIKey is ZQAUSFAYHMZIFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-10(2,3)7-6-8(12)9-11(4,5)13-9/h6-9,12H,1-5H3.
What are the key properties of 1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol?
1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol has a molecular weight of 184.28 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethyloxiran-2-yl)-4,4-dimethylpent-2-en-1-ol is sourced from PubChem (CID 91602244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).