C17H36O3S — CID 91602512
2-octylsulfinylnonane-1,3-diol (PubChem CID 91602512) has the molecular formula C17H36O3S and a molecular weight of 320.54 g/mol. Its IUPAC name is 2-octylsulfinylnonane-1,3-diol.
| Compound Name | 2-octylsulfinylnonane-1,3-diol |
|---|---|
| PubChem CID | 91602512 |
| Molecular Formula | C17H36O3S |
| Molecular Weight | 320.54 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 2-octylsulfinylnonane-1,3-diol |
| SMILES | CCCCCCCCS(=O)C(CO)C(O)CCCCCC |
| InChI | InChI=1S/C17H36O3S/c1-3-5-7-9-10-12-14-21(20)17(15-18)16(19)13-11-8-6-4-2/h16-19H,3-15H2,1-2H3 |
| InChIKey | HIPMGSYZVQEMBO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|