C18H19FN6O3 — CID 9160253
(2R)-N'-[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetyl]-2-(4-fluorophenoxy)propanehydrazide (PubChem CID 9160253) has the molecular formula C18H19FN6O3 and a molecular weight of 386.39 g/mol. Its IUPAC name is (2R)-N'-[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetyl]-2-(4-fluorophenoxy)propanehydrazide.
| Compound Name | (2R)-N'-[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetyl]-2-(4-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 9160253 |
| Molecular Formula | C18H19FN6O3 |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (2R)-N'-[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetyl]-2-(4-fluorophenoxy)propanehydrazide |
| SMILES | Cc1nc2ncnn2c(C)c1CC(=O)NNC(=O)[C@@H](C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C18H19FN6O3/c1-10-15(11(2)25-18(22-10)20-9-21-25)8-16(26)23-24-17(27)12(3)28-14-6-4-13(19)5-7-14/h4-7,9,12H,8H2,1-3H3,(H,23,26)(H,24,27)/t12-/m1/s1 |
| InChIKey | FZVOMGYZWDWDOZ-GFCCVEGCSA-N |
| XLogP | 1.04 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|