About ethane;(4-methylphenyl) N-methylmethanimidate
ethane;(4-methylphenyl) N-methylmethanimidate (PubChem CID 91602622) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is ethane;(4-methylphenyl) N-methylmethanimidate.
Molecular Properties
| Compound Name | ethane;(4-methylphenyl) N-methylmethanimidate |
| PubChem CID | 91602622 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | ethane;(4-methylphenyl) N-methylmethanimidate |
| SMILES | C/N=C/Oc1ccc(C)cc1.CC |
| InChI | InChI=1S/C9H11NO.C2H6/c1-8-3-5-9(6-4-8)11-7-10-2;1-2/h3-7H,1-2H3;1-2H3/b10-7+; |
| InChIKey | OABDPIAMPQLBKR-HCUGZAAXSA-N |
| XLogP | 3.06 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4-methylphenyl) N-methylmethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-methylphenyl) N-methylmethanimidate?
The IUPAC name of ethane;(4-methylphenyl) N-methylmethanimidate (CID 91602622) is ethane;(4-methylphenyl) N-methylmethanimidate.
What is the SMILES notation for ethane;(4-methylphenyl) N-methylmethanimidate?
The canonical SMILES for ethane;(4-methylphenyl) N-methylmethanimidate is C/N=C/Oc1ccc(C)cc1.CC.
What is the InChIKey of ethane;(4-methylphenyl) N-methylmethanimidate?
The InChIKey is OABDPIAMPQLBKR-HCUGZAAXSA-N. The full InChI is InChI=1S/C9H11NO.C2H6/c1-8-3-5-9(6-4-8)11-7-10-2;1-2/h3-7H,1-2H3;1-2H3/b10-7+;.
What are the key properties of ethane;(4-methylphenyl) N-methylmethanimidate?
ethane;(4-methylphenyl) N-methylmethanimidate has a molecular weight of 179.26 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-methylphenyl) N-methylmethanimidate is sourced from PubChem (CID 91602622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).