C10H12ClN3O2S2 — CID 91602655
6-chloro-2-prop-2-enyl-3,4-dihydro-1,2,4-benzothiadiazine-7-sulfonamide (PubChem CID 91602655) has the molecular formula C10H12ClN3O2S2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 6-chloro-2-prop-2-enyl-3,4-dihydro-1,2,4-benzothiadiazine-7-sulfonamide.
| Compound Name | 6-chloro-2-prop-2-enyl-3,4-dihydro-1,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| PubChem CID | 91602655 |
| Molecular Formula | C10H12ClN3O2S2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 6-chloro-2-prop-2-enyl-3,4-dihydro-1,2,4-benzothiadiazine-7-sulfonamide |
| SMILES | C=CCN1CNc2cc(Cl)c(S(N)(=O)=O)cc2S1 |
| InChI | InChI=1S/C10H12ClN3O2S2/c1-2-3-14-6-13-8-4-7(11)10(18(12,15)16)5-9(8)17-14/h2,4-5,13H,1,3,6H2,(H2,12,15,16) |
| InChIKey | WOFRYXBQRSDNMQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|