About N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide
N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide (PubChem CID 916027) has the molecular formula C18H15NO3
and a molecular weight of 293.32 g/mol. Its IUPAC name is N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide.
Molecular Properties
| Compound Name | N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide |
| PubChem CID | 916027 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H15NO3/c1-2-15(20)19-12-9-7-11(8-10-12)16-17(21)13-5-3-4-6-14(13)18(16)22/h3-10,16H,2H2,1H3,(H,19,20) |
| InChIKey | XXHWMZRYXTZBOD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide?
The IUPAC name of N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide (CID 916027) is N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide.
What is the SMILES notation for N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide?
The canonical SMILES for N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide is CCC(=O)Nc1ccc(C2C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide?
The InChIKey is XXHWMZRYXTZBOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO3/c1-2-15(20)19-12-9-7-11(8-10-12)16-17(21)13-5-3-4-6-14(13)18(16)22/h3-10,16H,2H2,1H3,(H,19,20).
What are the key properties of N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide?
N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide has a molecular weight of 293.32 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1,3-dioxoinden-2-yl)phenyl]propanamide is sourced from PubChem (CID 916027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).