C27H42O2 — CID 91602721
4-hydroxy-4-(2,3,9,13-tetramethyl-6-propan-2-ylidenetetradeca-2,8,12-trienyl)cyclohex-2-en-1-one (PubChem CID 91602721) has the molecular formula C27H42O2 and a molecular weight of 398.63 g/mol. Its IUPAC name is 4-hydroxy-4-(2,3,9,13-tetramethyl-6-propan-2-ylidenetetradeca-2,8,12-trienyl)cyclohex-2-en-1-one.
| Compound Name | 4-hydroxy-4-(2,3,9,13-tetramethyl-6-propan-2-ylidenetetradeca-2,8,12-trienyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 91602721 |
| Molecular Formula | C27H42O2 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | 4-hydroxy-4-(2,3,9,13-tetramethyl-6-propan-2-ylidenetetradeca-2,8,12-trienyl)cyclohex-2-en-1-one |
| SMILES | CC(C)=CCCC(C)=CCC(CCC(C)=C(C)CC1(O)C=CC(=O)CC1)=C(C)C |
| InChI | InChI=1S/C27H42O2/c1-20(2)9-8-10-22(5)11-13-25(21(3)4)14-12-23(6)24(7)19-27(29)17-15-26(28)16-18-27/h9,11,15,17,29H,8,10,12-14,16,18-19H2,1-7H3 |
| InChIKey | ZPMVZDHJFMWRPM-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|