C24H39NO4 — CID 91602744
3-hydroxy-2-(icosa-5,8,11,14-tetraenoylamino)butanoic acid (PubChem CID 91602744) has the molecular formula C24H39NO4 and a molecular weight of 405.58 g/mol. Its IUPAC name is 3-hydroxy-2-(icosa-5,8,11,14-tetraenoylamino)butanoic acid.
| Compound Name | 3-hydroxy-2-(icosa-5,8,11,14-tetraenoylamino)butanoic acid |
|---|---|
| PubChem CID | 91602744 |
| Molecular Formula | C24H39NO4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | 3-hydroxy-2-(icosa-5,8,11,14-tetraenoylamino)butanoic acid |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C24H39NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(27)25-23(21(2)26)24(28)29/h7-8,10-11,13-14,16-17,21,23,26H,3-6,9,12,15,18-20H2,1-2H3,(H,25,27)(H,28,29) |
| InChIKey | GTCXYWWBJBSQCG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|