C15H24 — CID 91602787
1,3-dimethyl-2,3,7,8,9,10,11,11a-octahydro-1H-cyclopenta[10]annulene (PubChem CID 91602787) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 1,3-dimethyl-2,3,7,8,9,10,11,11a-octahydro-1H-cyclopenta[10]annulene.
| Compound Name | 1,3-dimethyl-2,3,7,8,9,10,11,11a-octahydro-1H-cyclopenta[10]annulene |
|---|---|
| PubChem CID | 91602787 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 1,3-dimethyl-2,3,7,8,9,10,11,11a-octahydro-1H-cyclopenta[10]annulene |
| SMILES | CC1CC(C)C2CCCCCC=CC=C12 |
| InChI | InChI=1S/C15H24/c1-12-11-13(2)15-10-8-6-4-3-5-7-9-14(12)15/h5,7,9,12-13,15H,3-4,6,8,10-11H2,1-2H3 |
| InChIKey | NQQYDNBUFKSAGY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |