C21H30F6O6 — CID 91602821
1,1,1,3,3,3-hexafluoropropan-2-yl 2-methylbutanoate;(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate (PubChem CID 91602821) has the molecular formula C21H30F6O6 and a molecular weight of 492.45 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-methylbutanoate;(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-methylbutanoate;(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91602821 |
| Molecular Formula | C21H30F6O6 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-methylbutanoate;(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1C(=O)OC2CCCC21.CCC(C)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H20O4.C8H10F6O2/c1-4-13(2,3)12(15)17-10-8-6-5-7-9(8)16-11(10)14;1-3-4(2)5(15)16-6(7(9,10)11)8(12,13)14/h8-10H,4-7H2,1-3H3;4,6H,3H2,1-2H3 |
| InChIKey | VLODORPRIVLJFQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|