About 1,1-dimethoxy-N,N-dimethylmethanamine;ethane
1,1-dimethoxy-N,N-dimethylmethanamine;ethane (PubChem CID 91602918) has the molecular formula C7H19NO2
and a molecular weight of 149.23 g/mol. Its IUPAC name is 1,1-dimethoxy-N,N-dimethylmethanamine;ethane.
Molecular Properties
| Compound Name | 1,1-dimethoxy-N,N-dimethylmethanamine;ethane |
| PubChem CID | 91602918 |
| Molecular Formula | C7H19NO2 |
| Molecular Weight | 149.23 g/mol |
| Exact Mass | 149.14 |
| IUPAC Name | 1,1-dimethoxy-N,N-dimethylmethanamine;ethane |
| SMILES | CC.COC(OC)N(C)C |
| InChI | InChI=1S/C5H13NO2.C2H6/c1-6(2)5(7-3)8-4;1-2/h5H,1-4H3;1-2H3 |
| InChIKey | FKSWFUGMPRNEFY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxy-N,N-dimethylmethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxy-N,N-dimethylmethanamine;ethane?
The IUPAC name of 1,1-dimethoxy-N,N-dimethylmethanamine;ethane (CID 91602918) is 1,1-dimethoxy-N,N-dimethylmethanamine;ethane.
What is the SMILES notation for 1,1-dimethoxy-N,N-dimethylmethanamine;ethane?
The canonical SMILES for 1,1-dimethoxy-N,N-dimethylmethanamine;ethane is CC.COC(OC)N(C)C.
What is the InChIKey of 1,1-dimethoxy-N,N-dimethylmethanamine;ethane?
The InChIKey is FKSWFUGMPRNEFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO2.C2H6/c1-6(2)5(7-3)8-4;1-2/h5H,1-4H3;1-2H3.
What are the key properties of 1,1-dimethoxy-N,N-dimethylmethanamine;ethane?
1,1-dimethoxy-N,N-dimethylmethanamine;ethane has a molecular weight of 149.23 g/mol, XLogP of 1.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxy-N,N-dimethylmethanamine;ethane is sourced from PubChem (CID 91602918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).