About 1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea
1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea (PubChem CID 91602962) has the molecular formula C7H16N2O3S
and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea.
Molecular Properties
| Compound Name | 1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea |
| PubChem CID | 91602962 |
| Molecular Formula | C7H16N2O3S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea |
| SMILES | O=C(NCCCS)NCC(O)CO |
| InChI | InChI=1S/C7H16N2O3S/c10-5-6(11)4-9-7(12)8-2-1-3-13/h6,10-11,13H,1-5H2,(H2,8,9,12) |
| InChIKey | BUVLXJCPBKKEQI-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea?
The IUPAC name of 1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea (CID 91602962) is 1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea.
What is the SMILES notation for 1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea?
The canonical SMILES for 1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea is O=C(NCCCS)NCC(O)CO.
What is the InChIKey of 1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea?
The InChIKey is BUVLXJCPBKKEQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O3S/c10-5-6(11)4-9-7(12)8-2-1-3-13/h6,10-11,13H,1-5H2,(H2,8,9,12).
What are the key properties of 1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea?
1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea has a molecular weight of 208.28 g/mol, XLogP of -1.04, 6 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydroxypropyl)-3-(3-sulfanylpropyl)urea is sourced from PubChem (CID 91602962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).