C12H21N — CID 91603246
9-ethyl-2,7-dimethyl-4,5,6,7-tetrahydro-3H-azonine (PubChem CID 91603246) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 9-ethyl-2,7-dimethyl-4,5,6,7-tetrahydro-3H-azonine.
| Compound Name | 9-ethyl-2,7-dimethyl-4,5,6,7-tetrahydro-3H-azonine |
|---|---|
| PubChem CID | 91603246 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 9-ethyl-2,7-dimethyl-4,5,6,7-tetrahydro-3H-azonine |
| SMILES | CCC1=CC(C)CCCC/C(C)=N\1 |
| InChI | InChI=1S/C12H21N/c1-4-12-9-10(2)7-5-6-8-11(3)13-12/h9-10H,4-8H2,1-3H3/b12-9?,13-11- |
| InChIKey | IJKMJIYFJTXHOZ-QKKIICIQSA-N |
| XLogP | 3.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |