C17H17F4N3 — CID 91603402
N-[3-[3-cyclopropyl-6-(trifluoromethyl)-4,5-dihydrobenzimidazol-2-yl]-2-fluoropenta-1,3-dienyl]methanimine (PubChem CID 91603402) has the molecular formula C17H17F4N3 and a molecular weight of 339.34 g/mol. Its IUPAC name is N-[3-[3-cyclopropyl-6-(trifluoromethyl)-4,5-dihydrobenzimidazol-2-yl]-2-fluoropenta-1,3-dienyl]methanimine.
| Compound Name | N-[3-[3-cyclopropyl-6-(trifluoromethyl)-4,5-dihydrobenzimidazol-2-yl]-2-fluoropenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 91603402 |
| Molecular Formula | C17H17F4N3 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | N-[3-[3-cyclopropyl-6-(trifluoromethyl)-4,5-dihydrobenzimidazol-2-yl]-2-fluoropenta-1,3-dienyl]methanimine |
| SMILES | C=NC=C(F)C(=CC)c1nc2c(n1C1CC1)CCC(C(F)(F)F)=C2 |
| InChI | InChI=1S/C17H17F4N3/c1-3-12(13(18)9-22-2)16-23-14-8-10(17(19,20)21)4-7-15(14)24(16)11-5-6-11/h3,8-9,11H,2,4-7H2,1H3 |
| InChIKey | DBBPUHXLIQQFMP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|