C14H22F2 — CID 91603404
2-(2,3-difluoro-3,4-dimethylpent-4-en-2-yl)bicyclo[2.2.1]heptane (PubChem CID 91603404) has the molecular formula C14H22F2 and a molecular weight of 228.33 g/mol. Its IUPAC name is 2-(2,3-difluoro-3,4-dimethylpent-4-en-2-yl)bicyclo[2.2.1]heptane.
| Compound Name | 2-(2,3-difluoro-3,4-dimethylpent-4-en-2-yl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 91603404 |
| Molecular Formula | C14H22F2 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-(2,3-difluoro-3,4-dimethylpent-4-en-2-yl)bicyclo[2.2.1]heptane |
| SMILES | C=C(C)C(C)(F)C(C)(F)C1CC2CCC1C2 |
| InChI | InChI=1S/C14H22F2/c1-9(2)13(3,15)14(4,16)12-8-10-5-6-11(12)7-10/h10-12H,1,5-8H2,2-4H3 |
| InChIKey | PCDAKIWGEZEGPR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|