About 2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate
2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 91603973) has the molecular formula C13H21F3O2S
and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate |
| PubChem CID | 91603973 |
| Molecular Formula | C13H21F3O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)C.COC(=O)C1(C(F)(F)F)CC2CCC1S2 |
| InChI | InChI=1S/C9H11F3O2S.C4H10/c1-14-7(13)8(9(10,11)12)4-5-2-3-6(8)15-5;1-4(2)3/h5-6H,2-4H2,1H3;4H,1-3H3 |
| InChIKey | CAWQAAIUMCARTH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of 2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate (CID 91603973) is 2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for 2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for 2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate is CC(C)C.COC(=O)C1(C(F)(F)F)CC2CCC1S2.
What is the InChIKey of 2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is CAWQAAIUMCARTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3O2S.C4H10/c1-14-7(13)8(9(10,11)12)4-5-2-3-6(8)15-5;1-4(2)3/h5-6H,2-4H2,1H3;4H,1-3H3.
What are the key properties of 2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate?
2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 298.37 g/mol, XLogP of 4.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;methyl 2-(trifluoromethyl)-7-thiabicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 91603973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).