C29H37ClN10O2 — CID 91604077
methyl (2S)-2-[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-5-(diaminomethylideneamino)-2-(methylamino)pentanoate (PubChem CID 91604077) has the molecular formula C29H37ClN10O2 and a molecular weight of 593.14 g/mol. Its IUPAC name is methyl (2S)-2-[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-5-(diaminomethylideneamino)-2-(methylamino)pentanoate.
| Compound Name | methyl (2S)-2-[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-5-(diaminomethylideneamino)-2-(methylamino)pentanoate |
|---|---|
| PubChem CID | 91604077 |
| Molecular Formula | C29H37ClN10O2 |
| Molecular Weight | 593.14 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | methyl (2S)-2-[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-5-(diaminomethylideneamino)-2-(methylamino)pentanoate |
| SMILES | CCCCc1nc(Cl)c([C@](CCCN=C(N)N)(NC)C(=O)OC)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C29H37ClN10O2/c1-4-5-11-23-35-25(30)24(29(33-2,27(41)42-3)16-8-17-34-28(31)32)40(23)18-19-12-14-20(15-13-19)21-9-6-7-10-22(21)26-36-38-39-37-26/h6-7,9-10,12-15,33H,4-5,8,11,16-18H2,1-3H3,(H4,31,32,34)(H,36,37,38,39)/t29-/m0/s1 |
| InChIKey | DOMCGQLTRBGLLE-LJAQVGFWSA-N |
| XLogP | 3.42 |
| TPSA | 175.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.14 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|