About ethane;4-iminocyclohexa-2,5-dien-1-one
ethane;4-iminocyclohexa-2,5-dien-1-one (PubChem CID 91604232) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is ethane;4-iminocyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | ethane;4-iminocyclohexa-2,5-dien-1-one |
| PubChem CID | 91604232 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | ethane;4-iminocyclohexa-2,5-dien-1-one |
| SMILES | CC.[H]N=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C6H5NO.C2H6/c7-5-1-3-6(8)4-2-5;1-2/h1-4,7H;1-2H3 |
| InChIKey | FUHNOLQWBJFLDW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-iminocyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-iminocyclohexa-2,5-dien-1-one?
The IUPAC name of ethane;4-iminocyclohexa-2,5-dien-1-one (CID 91604232) is ethane;4-iminocyclohexa-2,5-dien-1-one.
What is the SMILES notation for ethane;4-iminocyclohexa-2,5-dien-1-one?
The canonical SMILES for ethane;4-iminocyclohexa-2,5-dien-1-one is CC.[H]N=C1C=CC(=O)C=C1.
What is the InChIKey of ethane;4-iminocyclohexa-2,5-dien-1-one?
The InChIKey is FUHNOLQWBJFLDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO.C2H6/c7-5-1-3-6(8)4-2-5;1-2/h1-4,7H;1-2H3.
What are the key properties of ethane;4-iminocyclohexa-2,5-dien-1-one?
ethane;4-iminocyclohexa-2,5-dien-1-one has a molecular weight of 137.18 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-iminocyclohexa-2,5-dien-1-one is sourced from PubChem (CID 91604232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).