About ethane;4-methyl-1,2-dihydronaphthalene
ethane;4-methyl-1,2-dihydronaphthalene (PubChem CID 91604572) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is ethane;4-methyl-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | ethane;4-methyl-1,2-dihydronaphthalene |
| PubChem CID | 91604572 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | ethane;4-methyl-1,2-dihydronaphthalene |
| SMILES | CC.CC.CC1=CCCc2ccccc21 |
| InChI | InChI=1S/C11H12.2C2H6/c1-9-5-4-7-10-6-2-3-8-11(9)10;2*1-2/h2-3,5-6,8H,4,7H2,1H3;2*1-2H3 |
| InChIKey | IEFIFLHSDSKZQC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;4-methyl-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-1,2-dihydronaphthalene?
The IUPAC name of ethane;4-methyl-1,2-dihydronaphthalene (CID 91604572) is ethane;4-methyl-1,2-dihydronaphthalene.
What is the SMILES notation for ethane;4-methyl-1,2-dihydronaphthalene?
The canonical SMILES for ethane;4-methyl-1,2-dihydronaphthalene is CC.CC.CC1=CCCc2ccccc21.
What is the InChIKey of ethane;4-methyl-1,2-dihydronaphthalene?
The InChIKey is IEFIFLHSDSKZQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12.2C2H6/c1-9-5-4-7-10-6-2-3-8-11(9)10;2*1-2/h2-3,5-6,8H,4,7H2,1H3;2*1-2H3.
What are the key properties of ethane;4-methyl-1,2-dihydronaphthalene?
ethane;4-methyl-1,2-dihydronaphthalene has a molecular weight of 204.36 g/mol, XLogP of 5.09, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-1,2-dihydronaphthalene is sourced from PubChem (CID 91604572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).